ElPaisaJuan ElPaisaJuan

02-10-2018
Mathematics

contestada

Determine the measure of the unknown labeled angles in the diagram above

Determine the measure of the unknown labeled angles in the diagram above class=

Respuesta :

allisoneymur allisoneymur

02-10-2018

180-68= 112
112/ 2= 56
180 - 56= 124
b = 124
Hope this right

Answer Link

Otras preguntas

The pH scale: ranges in value from 0.0 (acids) to 14.0 (bases) has a neutral point of 10 is defined with respect to the [OH−] ion includes all of these choices

cos(x/3)cos(x/3)=1/2(1+cos(2x/3))

If isosceles triangle ABC has a 130° angle at vertex B, which statement must be true? (attached file)

Which quantity is directly related to the temperature of a substance? average kinetic energy of the particles in the substance average size of the particles in

a cell with numerous ribosomes is probably specialized for? A. enzyme storage B. energy production C. cell division D. protein synthesis

Is 7/12 greater then 4/12

56b +356= -812 What is b? -17 over 2 -297 over 14 -26656 -66528

What times what gives you 36?

How many covalent bonds would you expect a neutral carbon atom to form in an organic compound?

which of the following instuments is consered pitched percussion A. Bass Drum B. Crash Cymbal C. Glockenspiel D. Snare Drum